C18H23BrN2O9S — CID 139632257
1-ethoxycarbonyloxyethyl (6R)-7-[(4-bromo-3-oxobutanoyl)amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 139632257) has the molecular formula C18H23BrN2O9S and a molecular weight of 523.36 g/mol. Its IUPAC name is 1-ethoxycarbonyloxyethyl (6R)-7-[(4-bromo-3-oxobutanoyl)amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | 1-ethoxycarbonyloxyethyl (6R)-7-[(4-bromo-3-oxobutanoyl)amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 139632257 |
| Molecular Formula | C18H23BrN2O9S |
| Molecular Weight | 523.36 g/mol |
| Exact Mass | 522.03 |
| IUPAC Name | 1-ethoxycarbonyloxyethyl (6R)-7-[(4-bromo-3-oxobutanoyl)amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CCOC(=O)OC(C)OC(=O)C1=C(COC)CS[C@@H]2C(NC(=O)CC(=O)CBr)C(=O)N12 |
| InChI | InChI=1S/C18H23BrN2O9S/c1-4-28-18(26)30-9(2)29-17(25)14-10(7-27-3)8-31-16-13(15(24)21(14)16)20-12(23)5-11(22)6-19/h9,13,16H,4-8H2,1-3H3,(H,20,23)/t9?,13?,16-/m1/s1 |
| InChIKey | MCITWOPAXQXWHX-SISHCKSZSA-N |
| XLogP | 0.70 |
| TPSA | 137.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.36 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|