C21H28ClN3O9S — CID 88660038
1-butanoyloxyethyl (6S)-7-[(4-chloro-2-ethoxyimino-3-oxobutanoyl)amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88660038) has the molecular formula C21H28ClN3O9S and a molecular weight of 533.99 g/mol. Its IUPAC name is 1-butanoyloxyethyl (6S)-7-[(4-chloro-2-ethoxyimino-3-oxobutanoyl)amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | 1-butanoyloxyethyl (6S)-7-[(4-chloro-2-ethoxyimino-3-oxobutanoyl)amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88660038 |
| Molecular Formula | C21H28ClN3O9S |
| Molecular Weight | 533.99 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | 1-butanoyloxyethyl (6S)-7-[(4-chloro-2-ethoxyimino-3-oxobutanoyl)amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CCCC(=O)OC(C)OC(=O)C1=C(COC)CS[C@H]2C(NC(=O)C(=NOCC)C(=O)CCl)C(=O)N12 |
| InChI | InChI=1S/C21H28ClN3O9S/c1-5-7-14(27)33-11(3)34-21(30)17-12(9-31-4)10-35-20-16(19(29)25(17)20)23-18(28)15(13(26)8-22)24-32-6-2/h11,16,20H,5-10H2,1-4H3,(H,23,28)/t11?,16?,20-/m0/s1 |
| InChIKey | FFWMIUXNUCHGAR-YZVLFUERSA-N |
| XLogP | 0.72 |
| TPSA | 149.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.99 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|