C20H22N4O10S2 — CID 131713977
1-ethoxycarbonyloxyethyl (6R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-oxoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 131713977) has the molecular formula C20H22N4O10S2 and a molecular weight of 542.55 g/mol. Its IUPAC name is 1-ethoxycarbonyloxyethyl (6R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-oxoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | 1-ethoxycarbonyloxyethyl (6R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-oxoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 131713977 |
| Molecular Formula | C20H22N4O10S2 |
| Molecular Weight | 542.55 g/mol |
| Exact Mass | 542.08 |
| IUPAC Name | 1-ethoxycarbonyloxyethyl (6R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-oxoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CCOC(=O)OC(C)OC(=O)C1=C(COC)CS[C@@H]2C(NC(=O)C(=O)c3csc(NC=O)n3)C(=O)N12 |
| InChI | InChI=1S/C20H22N4O10S2/c1-4-32-20(30)34-9(2)33-18(29)13-10(5-31-3)6-35-17-12(16(28)24(13)17)23-15(27)14(26)11-7-36-19(22-11)21-8-25/h7-9,12,17H,4-6H2,1-3H3,(H,23,27)(H,21,22,25)/t9?,12?,17-/m1/s1 |
| InChIKey | MRFLRPWMIKCHOP-IRMRZWDPSA-N |
| XLogP | 0.26 |
| TPSA | 179.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.55 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|