C21H28BrN3O10S — CID 10507707
[(1R)-1-propan-2-yloxycarbonyloxyethyl] (6R,7R)-7-[(4-bromo-3-oxobutanoyl)amino]-3-(dimethylcarbamoyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 10507707) has the molecular formula C21H28BrN3O10S and a molecular weight of 594.44 g/mol. Its IUPAC name is [(1R)-1-propan-2-yloxycarbonyloxyethyl] (6R,7R)-7-[(4-bromo-3-oxobutanoyl)amino]-3-(dimethylcarbamoyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | [(1R)-1-propan-2-yloxycarbonyloxyethyl] (6R,7R)-7-[(4-bromo-3-oxobutanoyl)amino]-3-(dimethylcarbamoyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 10507707 |
| Molecular Formula | C21H28BrN3O10S |
| Molecular Weight | 594.44 g/mol |
| Exact Mass | 593.07 |
| IUPAC Name | [(1R)-1-propan-2-yloxycarbonyloxyethyl] (6R,7R)-7-[(4-bromo-3-oxobutanoyl)amino]-3-(dimethylcarbamoyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(C)OC(=O)OC(C)OC(=O)C1=C(COC(=O)N(C)C)CS[C@@H]2[C@H](NC(=O)CC(=O)CBr)C(=O)N12 |
| InChI | InChI=1S/C21H28BrN3O10S/c1-10(2)33-21(31)35-11(3)34-19(29)16-12(8-32-20(30)24(4)5)9-36-18-15(17(28)25(16)18)23-14(27)6-13(26)7-22/h10-11,15,18H,6-9H2,1-5H3,(H,23,27)/t11?,15-,18-/m1/s1 |
| InChIKey | ACFZITFSZXOIRY-CNLMCJLYSA-N |
| XLogP | 1.14 |
| TPSA | 157.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.44 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|