C8H17FN2 — CID 54308569
5-fluoro-2-propylpent-2-ene-1,4-diamine (PubChem CID 54308569) has the molecular formula C8H17FN2 and a molecular weight of 160.24 g/mol. Its IUPAC name is 5-fluoro-2-propylpent-2-ene-1,4-diamine.
| Compound Name | 5-fluoro-2-propylpent-2-ene-1,4-diamine |
|---|---|
| PubChem CID | 54308569 |
| Molecular Formula | C8H17FN2 |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.14 |
| IUPAC Name | 5-fluoro-2-propylpent-2-ene-1,4-diamine |
| SMILES | CCCC(=CC(N)CF)CN |
| InChI | InChI=1S/C8H17FN2/c1-2-3-7(6-10)4-8(11)5-9/h4,8H,2-3,5-6,10-11H2,1H3 |
| InChIKey | SJGNPGOSBNNQCU-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|