C20H33ClO2 — CID 54312349
ethyl 2-[3-(6-chloro-2,6-diethyloctyl)cyclobut-2-en-1-ylidene]acetate (PubChem CID 54312349) has the molecular formula C20H33ClO2 and a molecular weight of 340.94 g/mol. Its IUPAC name is ethyl 2-[3-(6-chloro-2,6-diethyloctyl)cyclobut-2-en-1-ylidene]acetate.
| Compound Name | ethyl 2-[3-(6-chloro-2,6-diethyloctyl)cyclobut-2-en-1-ylidene]acetate |
|---|---|
| PubChem CID | 54312349 |
| Molecular Formula | C20H33ClO2 |
| Molecular Weight | 340.94 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | ethyl 2-[3-(6-chloro-2,6-diethyloctyl)cyclobut-2-en-1-ylidene]acetate |
| SMILES | CCOC(=O)C=C1C=C(CC(CC)CCCC(Cl)(CC)CC)C1 |
| InChI | InChI=1S/C20H33ClO2/c1-5-16(10-9-11-20(21,6-2)7-3)12-17-13-18(14-17)15-19(22)23-8-4/h13,15-16H,5-12,14H2,1-4H3 |
| InChIKey | SLTUYQGTDIGVOE-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.94 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|