C20H32O2 — CID 21399180
ethyl (2E)-2-[3-(2,5,6-trimethylhept-5-enyl)cyclohex-2-en-1-ylidene]acetate (PubChem CID 21399180) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is ethyl (2E)-2-[3-(2,5,6-trimethylhept-5-enyl)cyclohex-2-en-1-ylidene]acetate.
| Compound Name | ethyl (2E)-2-[3-(2,5,6-trimethylhept-5-enyl)cyclohex-2-en-1-ylidene]acetate |
|---|---|
| PubChem CID | 21399180 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | ethyl (2E)-2-[3-(2,5,6-trimethylhept-5-enyl)cyclohex-2-en-1-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1/C=C(CC(C)CCC(C)=C(C)C)CCC1 |
| InChI | InChI=1S/C20H32O2/c1-6-22-20(21)14-19-9-7-8-18(13-19)12-16(4)10-11-17(5)15(2)3/h13-14,16H,6-12H2,1-5H3/b19-14+ |
| InChIKey | OPQJGBWBOKIOLG-XMHGGMMESA-N |
| XLogP | 5.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|