C16H25O2- — CID 21488837
(2E)-2-[3-(2,6-dimethylheptyl)cyclopent-2-en-1-ylidene]acetate (PubChem CID 21488837) has the molecular formula C16H25O2- and a molecular weight of 249.37 g/mol. Its IUPAC name is (2E)-2-[3-(2,6-dimethylheptyl)cyclopent-2-en-1-ylidene]acetate.
| Compound Name | (2E)-2-[3-(2,6-dimethylheptyl)cyclopent-2-en-1-ylidene]acetate |
|---|---|
| PubChem CID | 21488837 |
| Molecular Formula | C16H25O2- |
| Molecular Weight | 249.37 g/mol |
| Exact Mass | 249.19 |
| IUPAC Name | (2E)-2-[3-(2,6-dimethylheptyl)cyclopent-2-en-1-ylidene]acetate |
| SMILES | CC(C)CCCC(C)CC1=C/C(=C/C(=O)[O-])CC1 |
| InChI | InChI=1S/C16H26O2/c1-12(2)5-4-6-13(3)9-14-7-8-15(10-14)11-16(17)18/h10-13H,4-9H2,1-3H3,(H,17,18)/p-1/b15-11+ |
| InChIKey | LFJSWXAXZRVOMD-RVDMUPIBSA-M |
| XLogP | 3.24 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|