C13H22O5 — CID 54312642
3-ethyl-4-[3-(2-methoxyethoxy)-2-methylpropyl]oxolane-2,5-dione (PubChem CID 54312642) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is 3-ethyl-4-[3-(2-methoxyethoxy)-2-methylpropyl]oxolane-2,5-dione.
| Compound Name | 3-ethyl-4-[3-(2-methoxyethoxy)-2-methylpropyl]oxolane-2,5-dione |
|---|---|
| PubChem CID | 54312642 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 3-ethyl-4-[3-(2-methoxyethoxy)-2-methylpropyl]oxolane-2,5-dione |
| SMILES | CCC1C(=O)OC(=O)C1CC(C)COCCOC |
| InChI | InChI=1S/C13H22O5/c1-4-10-11(13(15)18-12(10)14)7-9(2)8-17-6-5-16-3/h9-11H,4-8H2,1-3H3 |
| InChIKey | SLZFRYHNFHJUMH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|