C14H14N4O2 — CID 54314829
6-(oxolan-3-yloxy)imidazo[1,5-a]quinoxalin-4-amine (PubChem CID 54314829) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is 6-(oxolan-3-yloxy)imidazo[1,5-a]quinoxalin-4-amine.
| Compound Name | 6-(oxolan-3-yloxy)imidazo[1,5-a]quinoxalin-4-amine |
|---|---|
| PubChem CID | 54314829 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 6-(oxolan-3-yloxy)imidazo[1,5-a]quinoxalin-4-amine |
| SMILES | Nc1nc2c(OC3CCOC3)cccc2n2cncc12 |
| InChI | InChI=1S/C14H14N4O2/c15-14-11-6-16-8-18(11)10-2-1-3-12(13(10)17-14)20-9-4-5-19-7-9/h1-3,6,8-9H,4-5,7H2,(H2,15,17) |
| InChIKey | SNLDLYGKYREWOS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 74.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |