C19H22BrN5O2 — CID 5431557
4-bromo-N-[(E)-1-[3-(cyclobutanecarbonylamino)phenyl]ethylideneamino]-1,3-dimethylpyrazole-5-carboxamide (PubChem CID 5431557) has the molecular formula C19H22BrN5O2 and a molecular weight of 432.32 g/mol. Its IUPAC name is 4-bromo-N-[(E)-1-[3-(cyclobutanecarbonylamino)phenyl]ethylideneamino]-1,3-dimethylpyrazole-5-carboxamide.
| Compound Name | 4-bromo-N-[(E)-1-[3-(cyclobutanecarbonylamino)phenyl]ethylideneamino]-1,3-dimethylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 5431557 |
| Molecular Formula | C19H22BrN5O2 |
| Molecular Weight | 432.32 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 4-bromo-N-[(E)-1-[3-(cyclobutanecarbonylamino)phenyl]ethylideneamino]-1,3-dimethylpyrazole-5-carboxamide |
| SMILES | C/C(=N\NC(=O)c1c(Br)c(C)nn1C)c1cccc(NC(=O)C2CCC2)c1 |
| InChI | InChI=1S/C19H22BrN5O2/c1-11(22-23-19(27)17-16(20)12(2)24-25(17)3)14-8-5-9-15(10-14)21-18(26)13-6-4-7-13/h5,8-10,13H,4,6-7H2,1-3H3,(H,21,26)(H,23,27)/b22-11+ |
| InChIKey | KHSSMWYODSZZSL-SSDVNMTOSA-N |
| XLogP | 3.38 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.32 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|