C20H24ClN5O2 — CID 5431566
4-chloro-N-[(E)-1-[3-(cyclopentanecarbonylamino)phenyl]ethylideneamino]-1,3-dimethylpyrazole-5-carboxamide (PubChem CID 5431566) has the molecular formula C20H24ClN5O2 and a molecular weight of 401.90 g/mol. Its IUPAC name is 4-chloro-N-[(E)-1-[3-(cyclopentanecarbonylamino)phenyl]ethylideneamino]-1,3-dimethylpyrazole-5-carboxamide.
| Compound Name | 4-chloro-N-[(E)-1-[3-(cyclopentanecarbonylamino)phenyl]ethylideneamino]-1,3-dimethylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 5431566 |
| Molecular Formula | C20H24ClN5O2 |
| Molecular Weight | 401.90 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 4-chloro-N-[(E)-1-[3-(cyclopentanecarbonylamino)phenyl]ethylideneamino]-1,3-dimethylpyrazole-5-carboxamide |
| SMILES | C/C(=N\NC(=O)c1c(Cl)c(C)nn1C)c1cccc(NC(=O)C2CCCC2)c1 |
| InChI | InChI=1S/C20H24ClN5O2/c1-12(23-24-20(28)18-17(21)13(2)25-26(18)3)15-9-6-10-16(11-15)22-19(27)14-7-4-5-8-14/h6,9-11,14H,4-5,7-8H2,1-3H3,(H,22,27)(H,24,28)/b23-12+ |
| InChIKey | YTFPNGRCPZNEBV-FSJBWODESA-N |
| XLogP | 3.66 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.90 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|