C14H24O — CID 54316770
3-butyl-5,5-dimethylocta-3,7-dien-2-one (PubChem CID 54316770) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is 3-butyl-5,5-dimethylocta-3,7-dien-2-one.
| Compound Name | 3-butyl-5,5-dimethylocta-3,7-dien-2-one |
|---|---|
| PubChem CID | 54316770 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | 3-butyl-5,5-dimethylocta-3,7-dien-2-one |
| SMILES | C=CCC(C)(C)C=C(CCCC)C(C)=O |
| InChI | InChI=1S/C14H24O/c1-6-8-9-13(12(3)15)11-14(4,5)10-7-2/h7,11H,2,6,8-10H2,1,3-5H3 |
| InChIKey | SOTRFPRORCAJBS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|