C34H40FN3O3 — CID 54317169
[2-[4-(1-benzylpiperidin-4-yl)butylidene]-8-fluoro-1-oxo-3,4-dihydroacridin-9-yl]-tert-butylcarbamic acid (PubChem CID 54317169) has the molecular formula C34H40FN3O3 and a molecular weight of 557.71 g/mol. Its IUPAC name is [2-[4-(1-benzylpiperidin-4-yl)butylidene]-8-fluoro-1-oxo-3,4-dihydroacridin-9-yl]-tert-butylcarbamic acid.
| Compound Name | [2-[4-(1-benzylpiperidin-4-yl)butylidene]-8-fluoro-1-oxo-3,4-dihydroacridin-9-yl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 54317169 |
| Molecular Formula | C34H40FN3O3 |
| Molecular Weight | 557.71 g/mol |
| Exact Mass | 557.31 |
| IUPAC Name | [2-[4-(1-benzylpiperidin-4-yl)butylidene]-8-fluoro-1-oxo-3,4-dihydroacridin-9-yl]-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)c1c2c(nc3cccc(F)c13)CCC(=CCCCC1CCN(Cc3ccccc3)CC1)C2=O |
| InChI | InChI=1S/C34H40FN3O3/c1-34(2,3)38(33(40)41)31-29-26(35)14-9-15-27(29)36-28-17-16-25(32(39)30(28)31)13-8-7-10-23-18-20-37(21-19-23)22-24-11-5-4-6-12-24/h4-6,9,11-15,23H,7-8,10,16-22H2,1-3H3,(H,40,41) |
| InChIKey | SPAPHGMFCHWUJR-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.71 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|