C14H17N3O2S — CID 54318490
(2,3,6-trimethylphenyl) 2-(2H-triazol-4-ylsulfanyl)propanoate (PubChem CID 54318490) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is (2,3,6-trimethylphenyl) 2-(2H-triazol-4-ylsulfanyl)propanoate.
| Compound Name | (2,3,6-trimethylphenyl) 2-(2H-triazol-4-ylsulfanyl)propanoate |
|---|---|
| PubChem CID | 54318490 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | (2,3,6-trimethylphenyl) 2-(2H-triazol-4-ylsulfanyl)propanoate |
| SMILES | Cc1ccc(C)c(OC(=O)C(C)Sc2cn[nH]n2)c1C |
| InChI | InChI=1S/C14H17N3O2S/c1-8-5-6-9(2)13(10(8)3)19-14(18)11(4)20-12-7-15-17-16-12/h5-7,11H,1-4H3,(H,15,16,17) |
| InChIKey | SPXNXANCIRAZKB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|