C11H13NO4S — CID 1486219
6-[(2R)-1-ethoxy-1-oxopropan-2-yl]sulfanylpyridine-3-carboxylic acid (PubChem CID 1486219) has the molecular formula C11H13NO4S and a molecular weight of 255.29 g/mol. Its IUPAC name is 6-[(2R)-1-ethoxy-1-oxopropan-2-yl]sulfanylpyridine-3-carboxylic acid.
| Compound Name | 6-[(2R)-1-ethoxy-1-oxopropan-2-yl]sulfanylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 1486219 |
| Molecular Formula | C11H13NO4S |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 6-[(2R)-1-ethoxy-1-oxopropan-2-yl]sulfanylpyridine-3-carboxylic acid |
| SMILES | CCOC(=O)[C@@H](C)Sc1ccc(C(=O)O)cn1 |
| InChI | InChI=1S/C11H13NO4S/c1-3-16-11(15)7(2)17-9-5-4-8(6-12-9)10(13)14/h4-7H,3H2,1-2H3,(H,13,14)/t7-/m1/s1 |
| InChIKey | CIHCFXSUKGAFRF-SSDOTTSWSA-N |
| XLogP | 1.82 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |