C28H31N3O4 — CID 54318951
3-[1-[(1-methylindol-3-yl)methyl]-6-(4-methylpent-1-enyl)-3,5-dioxo-2H-1,4-benzodiazepin-4-yl]propanoic acid (PubChem CID 54318951) has the molecular formula C28H31N3O4 and a molecular weight of 473.57 g/mol. Its IUPAC name is 3-[1-[(1-methylindol-3-yl)methyl]-6-(4-methylpent-1-enyl)-3,5-dioxo-2H-1,4-benzodiazepin-4-yl]propanoic acid.
| Compound Name | 3-[1-[(1-methylindol-3-yl)methyl]-6-(4-methylpent-1-enyl)-3,5-dioxo-2H-1,4-benzodiazepin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 54318951 |
| Molecular Formula | C28H31N3O4 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 3-[1-[(1-methylindol-3-yl)methyl]-6-(4-methylpent-1-enyl)-3,5-dioxo-2H-1,4-benzodiazepin-4-yl]propanoic acid |
| SMILES | CC(C)CC=Cc1cccc2c1C(=O)N(CCC(=O)O)C(=O)CN2Cc1cn(C)c2ccccc12 |
| InChI | InChI=1S/C28H31N3O4/c1-19(2)8-6-9-20-10-7-13-24-27(20)28(35)31(15-14-26(33)34)25(32)18-30(24)17-21-16-29(3)23-12-5-4-11-22(21)23/h4-7,9-13,16,19H,8,14-15,17-18H2,1-3H3,(H,33,34) |
| InChIKey | SQFVEYNVZQJRAC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|