C20H18O2 — CID 154401488
1-(4-methylpent-1-enyl)anthracene-9,10-dione (PubChem CID 154401488) has the molecular formula C20H18O2 and a molecular weight of 290.36 g/mol. Its IUPAC name is 1-(4-methylpent-1-enyl)anthracene-9,10-dione.
| Compound Name | 1-(4-methylpent-1-enyl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 154401488 |
| Molecular Formula | C20H18O2 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 1-(4-methylpent-1-enyl)anthracene-9,10-dione |
| SMILES | CC(C)CC=Cc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H18O2/c1-13(2)7-5-8-14-9-6-12-17-18(14)20(22)16-11-4-3-10-15(16)19(17)21/h3-6,8-13H,7H2,1-2H3 |
| InChIKey | SHVKOEFVRMTMSF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|