C20H18F3NO3S — CID 54320035
[2-methyl-8-(2,4,6-trimethylphenyl)quinolin-4-yl] trifluoromethanesulfonate (PubChem CID 54320035) has the molecular formula C20H18F3NO3S and a molecular weight of 409.43 g/mol. Its IUPAC name is [2-methyl-8-(2,4,6-trimethylphenyl)quinolin-4-yl] trifluoromethanesulfonate.
| Compound Name | [2-methyl-8-(2,4,6-trimethylphenyl)quinolin-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 54320035 |
| Molecular Formula | C20H18F3NO3S |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | [2-methyl-8-(2,4,6-trimethylphenyl)quinolin-4-yl] trifluoromethanesulfonate |
| SMILES | Cc1cc(C)c(-c2cccc3c(OS(=O)(=O)C(F)(F)F)cc(C)nc23)c(C)c1 |
| InChI | InChI=1S/C20H18F3NO3S/c1-11-8-12(2)18(13(3)9-11)16-7-5-6-15-17(10-14(4)24-19(15)16)27-28(25,26)20(21,22)23/h5-10H,1-4H3 |
| InChIKey | SQZDALBSTDGJCX-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|