C9H14N3O9P — CID 54322038
[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate (PubChem CID 54322038) has the molecular formula C9H14N3O9P and a molecular weight of 339.20 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate.
| Compound Name | [(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 54322038 |
| Molecular Formula | C9H14N3O9P |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate |
| SMILES | Nc1ccn([C@@H]2O[C@H](CO)[C@](O)(OP(=O)(O)O)[C@@H]2O)c(=O)n1 |
| InChI | InChI=1S/C9H14N3O9P/c10-5-1-2-12(8(15)11-5)7-6(14)9(16,4(3-13)20-7)21-22(17,18)19/h1-2,4,6-7,13-14,16H,3H2,(H2,10,11,15)(H2,17,18,19)/t4-,6-,7-,9+/m1/s1 |
| InChIKey | SSILTUWRUZDFAZ-HCWSKCQFSA-N |
| XLogP | -3.13 |
| TPSA | 197.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | -3.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|