C35H37F2N7O4 — CID 54323619
4-[4-[4-[4-[[(2S,4R)-2-(2,4-difluorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-propan-2-yl-1,2,4-triazol-3-one (PubChem CID 54323619) has the molecular formula C35H37F2N7O4 and a molecular weight of 657.72 g/mol. Its IUPAC name is 4-[4-[4-[4-[[(2S,4R)-2-(2,4-difluorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-propan-2-yl-1,2,4-triazol-3-one.
| Compound Name | 4-[4-[4-[4-[[(2S,4R)-2-(2,4-difluorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-propan-2-yl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 54323619 |
| Molecular Formula | C35H37F2N7O4 |
| Molecular Weight | 657.72 g/mol |
| Exact Mass | 657.29 |
| IUPAC Name | 4-[4-[4-[4-[[(2S,4R)-2-(2,4-difluorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-propan-2-yl-1,2,4-triazol-3-one |
| SMILES | CC(C)n1ncn(-c2ccc(N3CCN(c4ccc(OC[C@@H]5CO[C@@](Cn6ccnc6)(c6ccc(F)cc6F)O5)cc4)CC3)cc2)c1=O |
| InChI | InChI=1S/C35H37F2N7O4/c1-25(2)44-34(45)43(24-39-44)29-6-4-27(5-7-29)41-15-17-42(18-16-41)28-8-10-30(11-9-28)46-20-31-21-47-35(48-31,22-40-14-13-38-23-40)32-12-3-26(36)19-33(32)37/h3-14,19,23-25,31H,15-18,20-22H2,1-2H3/t31-,35-/m1/s1 |
| InChIKey | STJJLWDXJRTMJX-CYEXUTLASA-N |
| XLogP | 4.76 |
| TPSA | 91.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.72 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|