About thiane-2-carboxamide
thiane-2-carboxamide (PubChem CID 54328325) has the molecular formula C6H11NOS
and a molecular weight of 145.23 g/mol. Its IUPAC name is thiane-2-carboxamide.
Molecular Properties
| Compound Name | thiane-2-carboxamide |
| PubChem CID | 54328325 |
| Molecular Formula | C6H11NOS |
| Molecular Weight | 145.23 g/mol |
| Exact Mass | 145.06 |
| IUPAC Name | thiane-2-carboxamide |
| SMILES | NC(=O)C1CCCCS1 |
| InChI | InChI=1S/C6H11NOS/c7-6(8)5-3-1-2-4-9-5/h5H,1-4H2,(H2,7,8) |
| InChIKey | SWNOTRQEQCOECX-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.23 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze thiane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiane-2-carboxamide?
The IUPAC name of thiane-2-carboxamide (CID 54328325) is thiane-2-carboxamide.
What is the SMILES notation for thiane-2-carboxamide?
The canonical SMILES for thiane-2-carboxamide is NC(=O)C1CCCCS1.
What is the InChIKey of thiane-2-carboxamide?
The InChIKey is SWNOTRQEQCOECX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NOS/c7-6(8)5-3-1-2-4-9-5/h5H,1-4H2,(H2,7,8).
What are the key properties of thiane-2-carboxamide?
thiane-2-carboxamide has a molecular weight of 145.23 g/mol, XLogP of 0.76, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for thiane-2-carboxamide is sourced from PubChem (CID 54328325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).