C14H24OS — CID 80622877
(3,5-dimethylcyclohexyl)-(thian-2-yl)methanone (PubChem CID 80622877) has the molecular formula C14H24OS and a molecular weight of 240.41 g/mol. Its IUPAC name is (3,5-dimethylcyclohexyl)-(thian-2-yl)methanone.
| Compound Name | (3,5-dimethylcyclohexyl)-(thian-2-yl)methanone |
|---|---|
| PubChem CID | 80622877 |
| Molecular Formula | C14H24OS |
| Molecular Weight | 240.41 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | (3,5-dimethylcyclohexyl)-(thian-2-yl)methanone |
| SMILES | CC1CC(C)CC(C(=O)C2CCCCS2)C1 |
| InChI | InChI=1S/C14H24OS/c1-10-7-11(2)9-12(8-10)14(15)13-5-3-4-6-16-13/h10-13H,3-9H2,1-2H3 |
| InChIKey | PLAAQPKYERSJCI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |