About N-ethyl-N-methylacetamide;N-ethyl-N-methylpropan-1-amine;N-methyl-N-propylacetamide
N-ethyl-N-methylacetamide;N-ethyl-N-methylpropan-1-amine;N-methyl-N-propylacetamide (PubChem CID 54328755) has the molecular formula C17H39N3O2
and a molecular weight of 317.52 g/mol. Its IUPAC name is N-ethyl-N-methylacetamide;N-ethyl-N-methylpropan-1-amine;N-methyl-N-propylacetamide.
Molecular Properties
| Compound Name | N-ethyl-N-methylacetamide;N-ethyl-N-methylpropan-1-amine;N-methyl-N-propylacetamide |
| PubChem CID | 54328755 |
| Molecular Formula | C17H39N3O2 |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.30 |
| IUPAC Name | N-ethyl-N-methylacetamide;N-ethyl-N-methylpropan-1-amine;N-methyl-N-propylacetamide |
| SMILES | CCCN(C)C(C)=O.CCCN(C)CC.CCN(C)C(C)=O |
| InChI | InChI=1S/C6H13NO.C6H15N.C5H11NO/c1-4-5-7(3)6(2)8;1-4-6-7(3)5-2;1-4-6(3)5(2)7/h4-5H2,1-3H3;4-6H2,1-3H3;4H2,1-3H3 |
| InChIKey | SWVFRLOUWCRKFA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-N-methylacetamide;N-ethyl-N-methylpropan-1-amine;N-methyl-N-propylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-methylacetamide;N-ethyl-N-methylpropan-1-amine;N-methyl-N-propylacetamide?
The IUPAC name of N-ethyl-N-methylacetamide;N-ethyl-N-methylpropan-1-amine;N-methyl-N-propylacetamide (CID 54328755) is N-ethyl-N-methylacetamide;N-ethyl-N-methylpropan-1-amine;N-methyl-N-propylacetamide.
What is the SMILES notation for N-ethyl-N-methylacetamide;N-ethyl-N-methylpropan-1-amine;N-methyl-N-propylacetamide?
The canonical SMILES for N-ethyl-N-methylacetamide;N-ethyl-N-methylpropan-1-amine;N-methyl-N-propylacetamide is CCCN(C)C(C)=O.CCCN(C)CC.CCN(C)C(C)=O.
What is the InChIKey of N-ethyl-N-methylacetamide;N-ethyl-N-methylpropan-1-amine;N-methyl-N-propylacetamide?
The InChIKey is SWVFRLOUWCRKFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO.C6H15N.C5H11NO/c1-4-5-7(3)6(2)8;1-4-6-7(3)5-2;1-4-6(3)5(2)7/h4-5H2,1-3H3;4-6H2,1-3H3;4H2,1-3H3.
What are the key properties of N-ethyl-N-methylacetamide;N-ethyl-N-methylpropan-1-amine;N-methyl-N-propylacetamide?
N-ethyl-N-methylacetamide;N-ethyl-N-methylpropan-1-amine;N-methyl-N-propylacetamide has a molecular weight of 317.52 g/mol, XLogP of 2.71, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-methylacetamide;N-ethyl-N-methylpropan-1-amine;N-methyl-N-propylacetamide is sourced from PubChem (CID 54328755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).