C29H52O8S2 — CID 54329403
tetrabutyl 3-butyl-1,5-bis(sulfanyl)pentane-1,2,4,5-tetracarboxylate (PubChem CID 54329403) has the molecular formula C29H52O8S2 and a molecular weight of 592.86 g/mol. Its IUPAC name is tetrabutyl 3-butyl-1,5-bis(sulfanyl)pentane-1,2,4,5-tetracarboxylate.
| Compound Name | tetrabutyl 3-butyl-1,5-bis(sulfanyl)pentane-1,2,4,5-tetracarboxylate |
|---|---|
| PubChem CID | 54329403 |
| Molecular Formula | C29H52O8S2 |
| Molecular Weight | 592.86 g/mol |
| Exact Mass | 592.31 |
| IUPAC Name | tetrabutyl 3-butyl-1,5-bis(sulfanyl)pentane-1,2,4,5-tetracarboxylate |
| SMILES | CCCCOC(=O)C(S)C(C(=O)OCCCC)C(CCCC)C(C(=O)OCCCC)C(S)C(=O)OCCCC |
| InChI | InChI=1S/C29H52O8S2/c1-6-11-16-21(22(26(30)34-17-12-7-2)24(38)28(32)36-19-14-9-4)23(27(31)35-18-13-8-3)25(39)29(33)37-20-15-10-5/h21-25,38-39H,6-20H2,1-5H3 |
| InChIKey | SXGXDIJCEQGWDQ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 105.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.86 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|