C21H20N4O3 — CID 54329815
5-[1-benzofuran-2-yl-(3,4-dimethoxyphenyl)methyl]pyrimidine-2,4-diamine (PubChem CID 54329815) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is 5-[1-benzofuran-2-yl-(3,4-dimethoxyphenyl)methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-[1-benzofuran-2-yl-(3,4-dimethoxyphenyl)methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 54329815 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 5-[1-benzofuran-2-yl-(3,4-dimethoxyphenyl)methyl]pyrimidine-2,4-diamine |
| SMILES | COc1ccc(C(c2cc3ccccc3o2)c2cnc(N)nc2N)cc1OC |
| InChI | InChI=1S/C21H20N4O3/c1-26-16-8-7-13(10-17(16)27-2)19(14-11-24-21(23)25-20(14)22)18-9-12-5-3-4-6-15(12)28-18/h3-11,19H,1-2H3,(H4,22,23,24,25) |
| InChIKey | SXNSHJUPDFHYEL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |