C14H18N4O2 — CID 11097745
5-[1-(3,4-dimethoxyphenyl)ethyl]pyrimidine-2,4-diamine (PubChem CID 11097745) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 5-[1-(3,4-dimethoxyphenyl)ethyl]pyrimidine-2,4-diamine.
| Compound Name | 5-[1-(3,4-dimethoxyphenyl)ethyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 11097745 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 5-[1-(3,4-dimethoxyphenyl)ethyl]pyrimidine-2,4-diamine |
| SMILES | COc1ccc(C(C)c2cnc(N)nc2N)cc1OC |
| InChI | InChI=1S/C14H18N4O2/c1-8(10-7-17-14(16)18-13(10)15)9-4-5-11(19-2)12(6-9)20-3/h4-8H,1-3H3,(H4,15,16,17,18) |
| InChIKey | BJRKJMXXXKAWNY-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |