C14H17IN4O3 — CID 87725645
5-(5-iodo-4-methoxy-2-propan-2-ylphenyl)peroxypyrimidine-2,4-diamine (PubChem CID 87725645) has the molecular formula C14H17IN4O3 and a molecular weight of 416.22 g/mol. Its IUPAC name is 5-(5-iodo-4-methoxy-2-propan-2-ylphenyl)peroxypyrimidine-2,4-diamine.
| Compound Name | 5-(5-iodo-4-methoxy-2-propan-2-ylphenyl)peroxypyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 87725645 |
| Molecular Formula | C14H17IN4O3 |
| Molecular Weight | 416.22 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | 5-(5-iodo-4-methoxy-2-propan-2-ylphenyl)peroxypyrimidine-2,4-diamine |
| SMILES | COc1cc(C(C)C)c(OOc2cnc(N)nc2N)cc1I |
| InChI | InChI=1S/C14H17IN4O3/c1-7(2)8-4-11(20-3)9(15)5-10(8)21-22-12-6-18-14(17)19-13(12)16/h4-7H,1-3H3,(H4,16,17,18,19) |
| InChIKey | WUMVSTCJDNPXLA-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 105.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.22 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|