C15H21N5O3 — CID 163788911
amino-[5-(2,4-diaminopyrimidin-5-yl)oxy-2-methoxy-4-propan-2-ylphenyl]methanol (PubChem CID 163788911) has the molecular formula C15H21N5O3 and a molecular weight of 319.37 g/mol. Its IUPAC name is amino-[5-(2,4-diaminopyrimidin-5-yl)oxy-2-methoxy-4-propan-2-ylphenyl]methanol.
| Compound Name | amino-[5-(2,4-diaminopyrimidin-5-yl)oxy-2-methoxy-4-propan-2-ylphenyl]methanol |
|---|---|
| PubChem CID | 163788911 |
| Molecular Formula | C15H21N5O3 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | amino-[5-(2,4-diaminopyrimidin-5-yl)oxy-2-methoxy-4-propan-2-ylphenyl]methanol |
| SMILES | COc1cc(C(C)C)c(Oc2cnc(N)nc2N)cc1C(N)O |
| InChI | InChI=1S/C15H21N5O3/c1-7(2)8-4-10(22-3)9(14(17)21)5-11(8)23-12-6-19-15(18)20-13(12)16/h4-7,14,21H,17H2,1-3H3,(H4,16,18,19,20) |
| InChIKey | MUYXFSWMWJBDEI-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 142.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|