C14H18N4O2 — CID 71206317
4-(2,4-diaminopyrimidin-5-yl)oxy-2-methyl-5-propan-2-ylphenol (PubChem CID 71206317) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 4-(2,4-diaminopyrimidin-5-yl)oxy-2-methyl-5-propan-2-ylphenol.
| Compound Name | 4-(2,4-diaminopyrimidin-5-yl)oxy-2-methyl-5-propan-2-ylphenol |
|---|---|
| PubChem CID | 71206317 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 4-(2,4-diaminopyrimidin-5-yl)oxy-2-methyl-5-propan-2-ylphenol |
| SMILES | Cc1cc(Oc2cnc(N)nc2N)c(C(C)C)cc1O |
| InChI | InChI=1S/C14H18N4O2/c1-7(2)9-5-10(19)8(3)4-11(9)20-12-6-17-14(16)18-13(12)15/h4-7,19H,1-3H3,(H4,15,16,17,18) |
| InChIKey | IMXJGDBIPKJDCS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 107.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |