C17H24N4O4 — CID 139460650
1-[[4-amino-5-(4,5-dimethoxy-2-propan-2-ylphenoxy)pyrimidin-2-yl]amino]ethanol (PubChem CID 139460650) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is 1-[[4-amino-5-(4,5-dimethoxy-2-propan-2-ylphenoxy)pyrimidin-2-yl]amino]ethanol.
| Compound Name | 1-[[4-amino-5-(4,5-dimethoxy-2-propan-2-ylphenoxy)pyrimidin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 139460650 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 1-[[4-amino-5-(4,5-dimethoxy-2-propan-2-ylphenoxy)pyrimidin-2-yl]amino]ethanol |
| SMILES | COc1cc(Oc2cnc(NC(C)O)nc2N)c(C(C)C)cc1OC |
| InChI | InChI=1S/C17H24N4O4/c1-9(2)11-6-13(23-4)14(24-5)7-12(11)25-15-8-19-17(20-10(3)22)21-16(15)18/h6-10,22H,1-5H3,(H3,18,19,20,21) |
| InChIKey | FTZBKHMGVVLGEQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 111.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|