C22H26N4O3 — CID 59598713
2-N-benzyl-5-(4,5-dimethoxy-2-propan-2-ylphenoxy)pyrimidine-2,4-diamine (PubChem CID 59598713) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is 2-N-benzyl-5-(4,5-dimethoxy-2-propan-2-ylphenoxy)pyrimidine-2,4-diamine.
| Compound Name | 2-N-benzyl-5-(4,5-dimethoxy-2-propan-2-ylphenoxy)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 59598713 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 2-N-benzyl-5-(4,5-dimethoxy-2-propan-2-ylphenoxy)pyrimidine-2,4-diamine |
| SMILES | COc1cc(Oc2cnc(NCc3ccccc3)nc2N)c(C(C)C)cc1OC |
| InChI | InChI=1S/C22H26N4O3/c1-14(2)16-10-18(27-3)19(28-4)11-17(16)29-20-13-25-22(26-21(20)23)24-12-15-8-6-5-7-9-15/h5-11,13-14H,12H2,1-4H3,(H3,23,24,25,26) |
| InChIKey | IQOHNAHDSJMKGD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |