C14H19N5OS — CID 158412823
N-[5-(2,4-diaminopyrimidin-5-yl)oxy-2-methyl-4-propan-2-ylphenyl]thiohydroxylamine (PubChem CID 158412823) has the molecular formula C14H19N5OS and a molecular weight of 305.41 g/mol. Its IUPAC name is N-[5-(2,4-diaminopyrimidin-5-yl)oxy-2-methyl-4-propan-2-ylphenyl]thiohydroxylamine.
| Compound Name | N-[5-(2,4-diaminopyrimidin-5-yl)oxy-2-methyl-4-propan-2-ylphenyl]thiohydroxylamine |
|---|---|
| PubChem CID | 158412823 |
| Molecular Formula | C14H19N5OS |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | N-[5-(2,4-diaminopyrimidin-5-yl)oxy-2-methyl-4-propan-2-ylphenyl]thiohydroxylamine |
| SMILES | Cc1cc(C(C)C)c(Oc2cnc(N)nc2N)cc1NS |
| InChI | InChI=1S/C14H19N5OS/c1-7(2)9-4-8(3)10(19-21)5-11(9)20-12-6-17-14(16)18-13(12)15/h4-7,19,21H,1-3H3,(H4,15,16,17,18) |
| InChIKey | FYXBZQPJKMTSOR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|