C12H10Br2N2 — CID 54330183
2,3-dibromo-4,5-dimethyl-6-pyridin-2-ylpyridine (PubChem CID 54330183) has the molecular formula C12H10Br2N2 and a molecular weight of 342.03 g/mol. Its IUPAC name is 2,3-dibromo-4,5-dimethyl-6-pyridin-2-ylpyridine.
| Compound Name | 2,3-dibromo-4,5-dimethyl-6-pyridin-2-ylpyridine |
|---|---|
| PubChem CID | 54330183 |
| Molecular Formula | C12H10Br2N2 |
| Molecular Weight | 342.03 g/mol |
| Exact Mass | 339.92 |
| IUPAC Name | 2,3-dibromo-4,5-dimethyl-6-pyridin-2-ylpyridine |
| SMILES | Cc1c(-c2ccccn2)nc(Br)c(Br)c1C |
| InChI | InChI=1S/C12H10Br2N2/c1-7-8(2)11(16-12(14)10(7)13)9-5-3-4-6-15-9/h3-6H,1-2H3 |
| InChIKey | SXUGLRQUWZZITI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.03 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|