C16H12Br2N4 — CID 11582517
2,3-bis(bromomethyl)-5,6-dipyridin-2-ylpyrazine (PubChem CID 11582517) has the molecular formula C16H12Br2N4 and a molecular weight of 420.11 g/mol. Its IUPAC name is 2,3-bis(bromomethyl)-5,6-dipyridin-2-ylpyrazine.
| Compound Name | 2,3-bis(bromomethyl)-5,6-dipyridin-2-ylpyrazine |
|---|---|
| PubChem CID | 11582517 |
| Molecular Formula | C16H12Br2N4 |
| Molecular Weight | 420.11 g/mol |
| Exact Mass | 417.94 |
| IUPAC Name | 2,3-bis(bromomethyl)-5,6-dipyridin-2-ylpyrazine |
| SMILES | BrCc1nc(-c2ccccn2)c(-c2ccccn2)nc1CBr |
| InChI | InChI=1S/C16H12Br2N4/c17-9-13-14(10-18)22-16(12-6-2-4-8-20-12)15(21-13)11-5-1-3-7-19-11/h1-8H,9-10H2 |
| InChIKey | VPRKAPOIABFQKA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.11 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|