C24H19ClO2S2 — CID 54332062
2-(4-chlorophenyl)sulfanyl-3,5-bis(4-methoxyphenyl)thiophene (PubChem CID 54332062) has the molecular formula C24H19ClO2S2 and a molecular weight of 439.00 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-3,5-bis(4-methoxyphenyl)thiophene.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-3,5-bis(4-methoxyphenyl)thiophene |
|---|---|
| PubChem CID | 54332062 |
| Molecular Formula | C24H19ClO2S2 |
| Molecular Weight | 439.00 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-3,5-bis(4-methoxyphenyl)thiophene |
| SMILES | COc1ccc(-c2cc(-c3ccc(OC)cc3)c(Sc3ccc(Cl)cc3)s2)cc1 |
| InChI | InChI=1S/C24H19ClO2S2/c1-26-19-9-3-16(4-10-19)22-15-23(17-5-11-20(27-2)12-6-17)29-24(22)28-21-13-7-18(25)8-14-21/h3-15H,1-2H3 |
| InChIKey | SZALRHYGKDXQCX-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.00 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |