C19H16F2O2 — CID 54334338
3-[(1R)-2,2-bis(3-fluorophenyl)-1-methylcyclopropyl]prop-2-enoic acid (PubChem CID 54334338) has the molecular formula C19H16F2O2 and a molecular weight of 314.33 g/mol. Its IUPAC name is 3-[(1R)-2,2-bis(3-fluorophenyl)-1-methylcyclopropyl]prop-2-enoic acid.
| Compound Name | 3-[(1R)-2,2-bis(3-fluorophenyl)-1-methylcyclopropyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 54334338 |
| Molecular Formula | C19H16F2O2 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 3-[(1R)-2,2-bis(3-fluorophenyl)-1-methylcyclopropyl]prop-2-enoic acid |
| SMILES | C[C@]1(C=CC(=O)O)CC1(c1cccc(F)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C19H16F2O2/c1-18(9-8-17(22)23)12-19(18,13-4-2-6-15(20)10-13)14-5-3-7-16(21)11-14/h2-11H,12H2,1H3,(H,22,23)/t18-/m0/s1 |
| InChIKey | TUJQAUMKHVCRSP-SFHVURJKSA-N |
| XLogP | 4.30 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|