C15H22FNO3 — CID 142514919
ethane;1-(3-fluorophenyl)-3,3-dimethoxycyclobutane-1-carboxamide (PubChem CID 142514919) has the molecular formula C15H22FNO3 and a molecular weight of 283.34 g/mol. Its IUPAC name is ethane;1-(3-fluorophenyl)-3,3-dimethoxycyclobutane-1-carboxamide.
| Compound Name | ethane;1-(3-fluorophenyl)-3,3-dimethoxycyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 142514919 |
| Molecular Formula | C15H22FNO3 |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | ethane;1-(3-fluorophenyl)-3,3-dimethoxycyclobutane-1-carboxamide |
| SMILES | CC.COC1(OC)CC(C(N)=O)(c2cccc(F)c2)C1 |
| InChI | InChI=1S/C13H16FNO3.C2H6/c1-17-13(18-2)7-12(8-13,11(15)16)9-4-3-5-10(14)6-9;1-2/h3-6H,7-8H2,1-2H3,(H2,15,16);1-2H3 |
| InChIKey | QILSOCUHKGRXIV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|