C13H18FNO2 — CID 64905235
[1-(3-fluorophenyl)-3,3-dimethoxycyclobutyl]methanamine (PubChem CID 64905235) has the molecular formula C13H18FNO2 and a molecular weight of 239.29 g/mol. Its IUPAC name is [1-(3-fluorophenyl)-3,3-dimethoxycyclobutyl]methanamine.
| Compound Name | [1-(3-fluorophenyl)-3,3-dimethoxycyclobutyl]methanamine |
|---|---|
| PubChem CID | 64905235 |
| Molecular Formula | C13H18FNO2 |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | [1-(3-fluorophenyl)-3,3-dimethoxycyclobutyl]methanamine |
| SMILES | COC1(OC)CC(CN)(c2cccc(F)c2)C1 |
| InChI | InChI=1S/C13H18FNO2/c1-16-13(17-2)7-12(8-13,9-15)10-4-3-5-11(14)6-10/h3-6H,7-9,15H2,1-2H3 |
| InChIKey | UEMGCFYVPJTNFA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|