C14H16FN3O3 — CID 137419677
1-(3-fluorophenyl)-3-formamido-3-N-methylcyclobutane-1,3-dicarboxamide (PubChem CID 137419677) has the molecular formula C14H16FN3O3 and a molecular weight of 293.30 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-formamido-3-N-methylcyclobutane-1,3-dicarboxamide.
| Compound Name | 1-(3-fluorophenyl)-3-formamido-3-N-methylcyclobutane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 137419677 |
| Molecular Formula | C14H16FN3O3 |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 1-(3-fluorophenyl)-3-formamido-3-N-methylcyclobutane-1,3-dicarboxamide |
| SMILES | CNC(=O)C1(NC=O)CC(C(N)=O)(c2cccc(F)c2)C1 |
| InChI | InChI=1S/C14H16FN3O3/c1-17-12(21)14(18-8-19)6-13(7-14,11(16)20)9-3-2-4-10(15)5-9/h2-5,8H,6-7H2,1H3,(H2,16,20)(H,17,21)(H,18,19) |
| InChIKey | NXZBPAJADVAYGS-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|