1-(2-chloro-4-fluoro-3-nitrophenyl)ethyl nitrate

C8H6ClFN2O5 — CID 54336079

IUPAC1-(2-chloro-4-fluoro-3-nitrophenyl)ethyl nitrate
SMILESCC(O[N+](=O)[O-])c1ccc(F)c([N+](=O)[O-])c1Cl
InChIInChI=1S/C8H6ClFN2O5/c1-4(17-12(15)16)5-2-3-6(10)8(7(5)9)11(13)14/h2-4H,1H3
InChIKeyTVOFSASYXXAYFT-UHFFFAOYSA-N
MW264.60 g/mol
LogP2.66
Rot. Bonds4

About 1-(2-chloro-4-fluoro-3-nitrophenyl)ethyl nitrate

1-(2-chloro-4-fluoro-3-nitrophenyl)ethyl nitrate (PubChem CID 54336079) has the molecular formula C8H6ClFN2O5 and a molecular weight of 264.60 g/mol. Its IUPAC name is 1-(2-chloro-4-fluoro-3-nitrophenyl)ethyl nitrate.

Molecular Properties

Compound Name1-(2-chloro-4-fluoro-3-nitrophenyl)ethyl nitrate
PubChem CID54336079
Molecular FormulaC8H6ClFN2O5
Molecular Weight264.60 g/mol
Exact Mass263.99
IUPAC Name1-(2-chloro-4-fluoro-3-nitrophenyl)ethyl nitrate
SMILESCC(O[N+](=O)[O-])c1ccc(F)c([N+](=O)[O-])c1Cl
InChIInChI=1S/C8H6ClFN2O5/c1-4(17-12(15)16)5-2-3-6(10)8(7(5)9)11(13)14/h2-4H,1H3
InChIKeyTVOFSASYXXAYFT-UHFFFAOYSA-N
XLogP2.66
TPSA95.51 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.60
LogP ≤ 52.66
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 1-(2-chloro-4-fluoro-3-nitrophenyl)ethyl nitrate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(2-chloro-4-fluoro-3-nitrophenyl)ethyl nitrate?
The IUPAC name of 1-(2-chloro-4-fluoro-3-nitrophenyl)ethyl nitrate (CID 54336079) is 1-(2-chloro-4-fluoro-3-nitrophenyl)ethyl nitrate.
What is the SMILES notation for 1-(2-chloro-4-fluoro-3-nitrophenyl)ethyl nitrate?
The canonical SMILES for 1-(2-chloro-4-fluoro-3-nitrophenyl)ethyl nitrate is CC(O[N+](=O)[O-])c1ccc(F)c([N+](=O)[O-])c1Cl.
What is the InChIKey of 1-(2-chloro-4-fluoro-3-nitrophenyl)ethyl nitrate?
The InChIKey is TVOFSASYXXAYFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClFN2O5/c1-4(17-12(15)16)5-2-3-6(10)8(7(5)9)11(13)14/h2-4H,1H3.
What are the key properties of 1-(2-chloro-4-fluoro-3-nitrophenyl)ethyl nitrate?
1-(2-chloro-4-fluoro-3-nitrophenyl)ethyl nitrate has a molecular weight of 264.60 g/mol, XLogP of 2.66, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chloro-4-fluoro-3-nitrophenyl)ethyl nitrate is sourced from PubChem (CID 54336079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).