C16H30O6 — CID 543364
2,3,4,5-tetrahydroxypentyl undec-10-enoate (PubChem CID 543364) has the molecular formula C16H30O6 and a molecular weight of 318.41 g/mol. Its IUPAC name is 2,3,4,5-tetrahydroxypentyl undec-10-enoate.
| Compound Name | 2,3,4,5-tetrahydroxypentyl undec-10-enoate |
|---|---|
| PubChem CID | 543364 |
| Molecular Formula | C16H30O6 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | 2,3,4,5-tetrahydroxypentyl undec-10-enoate |
| SMILES | C=CCCCCCCCCC(=O)OCC(O)C(O)C(O)CO |
| InChI | InChI=1S/C16H30O6/c1-2-3-4-5-6-7-8-9-10-15(20)22-12-14(19)16(21)13(18)11-17/h2,13-14,16-19,21H,1,3-12H2 |
| InChIKey | HKPTZHNHCKJZAQ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|