C20H18Br2O3 — CID 54340914
cis-(3-phenoxyphenyl) (1R,3S)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 54340914) has the molecular formula C20H18Br2O3 and a molecular weight of 466.17 g/mol. Its IUPAC name is cis-(3-phenoxyphenyl) (1R,3S)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | cis-(3-phenoxyphenyl) (1R,3S)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 54340914 |
| Molecular Formula | C20H18Br2O3 |
| Molecular Weight | 466.17 g/mol |
| Exact Mass | 463.96 |
| IUPAC Name | cis-(3-phenoxyphenyl) (1R,3S)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC1(C)[C@H](C=C(Br)Br)[C@H]1C(=O)Oc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C20H18Br2O3/c1-20(2)16(12-17(21)22)18(20)19(23)25-15-10-6-9-14(11-15)24-13-7-4-3-5-8-13/h3-12,16,18H,1-2H3/t16-,18+/m1/s1 |
| InChIKey | TYWUUKLNKHPVRN-AEFFLSMTSA-N |
| XLogP | 6.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.17 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|