C18H16Br2O2 — CID 27210138
cis-naphthalen-1-yl (1S,3R)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 27210138) has the molecular formula C18H16Br2O2 and a molecular weight of 424.13 g/mol. Its IUPAC name is cis-naphthalen-1-yl (1S,3R)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | cis-naphthalen-1-yl (1S,3R)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 27210138 |
| Molecular Formula | C18H16Br2O2 |
| Molecular Weight | 424.13 g/mol |
| Exact Mass | 421.95 |
| IUPAC Name | cis-naphthalen-1-yl (1S,3R)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC1(C)[C@@H](C=C(Br)Br)[C@@H]1C(=O)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C18H16Br2O2/c1-18(2)13(10-15(19)20)16(18)17(21)22-14-9-5-7-11-6-3-4-8-12(11)14/h3-10,13,16H,1-2H3/t13-,16+/m0/s1 |
| InChIKey | LCWOCTSWSRGYOZ-XJKSGUPXSA-N |
| XLogP | 5.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.13 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|