C8H9Br3O — CID 54565449
3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carbonyl bromide (PubChem CID 54565449) has the molecular formula C8H9Br3O and a molecular weight of 360.87 g/mol. Its IUPAC name is 3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carbonyl bromide.
| Compound Name | 3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carbonyl bromide |
|---|---|
| PubChem CID | 54565449 |
| Molecular Formula | C8H9Br3O |
| Molecular Weight | 360.87 g/mol |
| Exact Mass | 357.82 |
| IUPAC Name | 3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carbonyl bromide |
| SMILES | CC1(C)C(C=C(Br)Br)C1C(=O)Br |
| InChI | InChI=1S/C8H9Br3O/c1-8(2)4(3-5(9)10)6(8)7(11)12/h3-4,6H,1-2H3 |
| InChIKey | ZTMNCUNAWONUPB-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.87 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|