C15H13Br2F2IO2 — CID 89179680
trans-(2,6-difluoro-3-iodophenyl)methyl (1R,3R)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 89179680) has the molecular formula C15H13Br2F2IO2 and a molecular weight of 549.98 g/mol. Its IUPAC name is trans-(2,6-difluoro-3-iodophenyl)methyl (1R,3R)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | trans-(2,6-difluoro-3-iodophenyl)methyl (1R,3R)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 89179680 |
| Molecular Formula | C15H13Br2F2IO2 |
| Molecular Weight | 549.98 g/mol |
| Exact Mass | 547.83 |
| IUPAC Name | trans-(2,6-difluoro-3-iodophenyl)methyl (1R,3R)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC1(C)[C@H](C(=O)OCc2c(F)ccc(I)c2F)[C@@H]1C=C(Br)Br |
| InChI | InChI=1S/C15H13Br2F2IO2/c1-15(2)8(5-11(16)17)12(15)14(21)22-6-7-9(18)3-4-10(20)13(7)19/h3-5,8,12H,6H2,1-2H3/t8-,12-/m0/s1 |
| InChIKey | PHYMSGGUCCTYIN-UFBFGSQYSA-N |
| XLogP | 5.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.98 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|