C16H9Cl3O3 — CID 54341151
3-[2-oxo-2-(2,3,4-trichlorophenyl)ethyl]-3H-2-benzofuran-1-one (PubChem CID 54341151) has the molecular formula C16H9Cl3O3 and a molecular weight of 355.60 g/mol. Its IUPAC name is 3-[2-oxo-2-(2,3,4-trichlorophenyl)ethyl]-3H-2-benzofuran-1-one.
| Compound Name | 3-[2-oxo-2-(2,3,4-trichlorophenyl)ethyl]-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 54341151 |
| Molecular Formula | C16H9Cl3O3 |
| Molecular Weight | 355.60 g/mol |
| Exact Mass | 353.96 |
| IUPAC Name | 3-[2-oxo-2-(2,3,4-trichlorophenyl)ethyl]-3H-2-benzofuran-1-one |
| SMILES | O=C1OC(CC(=O)c2ccc(Cl)c(Cl)c2Cl)c2ccccc21 |
| InChI | InChI=1S/C16H9Cl3O3/c17-11-6-5-10(14(18)15(11)19)12(20)7-13-8-3-1-2-4-9(8)16(21)22-13/h1-6,13H,7H2 |
| InChIKey | TZAVOXNDPJXUOJ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.60 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|