2-acetyloxydec-2-enoic acid

C12H20O4 — CID 54342046

IUPAC2-acetyloxydec-2-enoic acid
SMILESCCCCCCCC=C(OC(C)=O)C(=O)O
InChIInChI=1S/C12H20O4/c1-3-4-5-6-7-8-9-11(12(14)15)16-10(2)13/h9H,3-8H2,1-2H3,(H,14,15)
InChIKeyTZQPASWDLSFLPV-UHFFFAOYSA-N
MW228.29 g/mol
LogP2.88
Rot. Bonds8

About 2-acetyloxydec-2-enoic acid

2-acetyloxydec-2-enoic acid (PubChem CID 54342046) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is 2-acetyloxydec-2-enoic acid.

Molecular Properties

Compound Name2-acetyloxydec-2-enoic acid
PubChem CID54342046
Molecular FormulaC12H20O4
Molecular Weight228.29 g/mol
Exact Mass228.14
IUPAC Name2-acetyloxydec-2-enoic acid
SMILESCCCCCCCC=C(OC(C)=O)C(=O)O
InChIInChI=1S/C12H20O4/c1-3-4-5-6-7-8-9-11(12(14)15)16-10(2)13/h9H,3-8H2,1-2H3,(H,14,15)
InChIKeyTZQPASWDLSFLPV-UHFFFAOYSA-N
XLogP2.88
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.29
LogP ≤ 52.88
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-acetyloxydec-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-acetyloxydec-2-enoic acid?
The IUPAC name of 2-acetyloxydec-2-enoic acid (CID 54342046) is 2-acetyloxydec-2-enoic acid.
What is the SMILES notation for 2-acetyloxydec-2-enoic acid?
The canonical SMILES for 2-acetyloxydec-2-enoic acid is CCCCCCCC=C(OC(C)=O)C(=O)O.
What is the InChIKey of 2-acetyloxydec-2-enoic acid?
The InChIKey is TZQPASWDLSFLPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O4/c1-3-4-5-6-7-8-9-11(12(14)15)16-10(2)13/h9H,3-8H2,1-2H3,(H,14,15).
What are the key properties of 2-acetyloxydec-2-enoic acid?
2-acetyloxydec-2-enoic acid has a molecular weight of 228.29 g/mol, XLogP of 2.88, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyloxydec-2-enoic acid is sourced from PubChem (CID 54342046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).