C13H21NO6 — CID 54344497
7-(2,5-dihydroxypyrrol-1-yl)-6,6-dimethoxyheptanoic acid (PubChem CID 54344497) has the molecular formula C13H21NO6 and a molecular weight of 287.31 g/mol. Its IUPAC name is 7-(2,5-dihydroxypyrrol-1-yl)-6,6-dimethoxyheptanoic acid.
| Compound Name | 7-(2,5-dihydroxypyrrol-1-yl)-6,6-dimethoxyheptanoic acid |
|---|---|
| PubChem CID | 54344497 |
| Molecular Formula | C13H21NO6 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 7-(2,5-dihydroxypyrrol-1-yl)-6,6-dimethoxyheptanoic acid |
| SMILES | COC(CCCCC(=O)O)(Cn1c(O)ccc1O)OC |
| InChI | InChI=1S/C13H21NO6/c1-19-13(20-2,8-4-3-5-12(17)18)9-14-10(15)6-7-11(14)16/h6-7,15-16H,3-5,8-9H2,1-2H3,(H,17,18) |
| InChIKey | UBIKCTXYRUUZRP-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|