C33H29N3O12S — CID 54347196
2-[2-[2-[3-(1,3-benzothiazol-2-yl)-7-[bis(carboxymethyl)amino]-2-oxochromen-6-yl]oxyethoxy]-N-(carboxymethyl)-4-methylanilino]acetic acid (PubChem CID 54347196) has the molecular formula C33H29N3O12S and a molecular weight of 691.67 g/mol. Its IUPAC name is 2-[2-[2-[3-(1,3-benzothiazol-2-yl)-7-[bis(carboxymethyl)amino]-2-oxochromen-6-yl]oxyethoxy]-N-(carboxymethyl)-4-methylanilino]acetic acid.
| Compound Name | 2-[2-[2-[3-(1,3-benzothiazol-2-yl)-7-[bis(carboxymethyl)amino]-2-oxochromen-6-yl]oxyethoxy]-N-(carboxymethyl)-4-methylanilino]acetic acid |
|---|---|
| PubChem CID | 54347196 |
| Molecular Formula | C33H29N3O12S |
| Molecular Weight | 691.67 g/mol |
| Exact Mass | 691.15 |
| IUPAC Name | 2-[2-[2-[3-(1,3-benzothiazol-2-yl)-7-[bis(carboxymethyl)amino]-2-oxochromen-6-yl]oxyethoxy]-N-(carboxymethyl)-4-methylanilino]acetic acid |
| SMILES | Cc1ccc(N(CC(=O)O)CC(=O)O)c(OCCOc2cc3cc(-c4nc5ccccc5s4)c(=O)oc3cc2N(CC(=O)O)CC(=O)O)c1 |
| InChI | InChI=1S/C33H29N3O12S/c1-18-6-7-22(35(14-28(37)38)15-29(39)40)25(10-18)46-8-9-47-26-12-19-11-20(32-34-21-4-2-3-5-27(21)49-32)33(45)48-24(19)13-23(26)36(16-30(41)42)17-31(43)44/h2-7,10-13H,8-9,14-17H2,1H3,(H,37,38)(H,39,40)(H,41,42)(H,43,44) |
| InChIKey | UDCVOQKFOJLSID-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 217.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.67 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|